C27H29NO — CID 139036050
3,6-ditert-butyl-10-phenylacridin-9-one (PubChem CID 139036050) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is 3,6-ditert-butyl-10-phenylacridin-9-one.
| Compound Name | 3,6-ditert-butyl-10-phenylacridin-9-one |
|---|---|
| PubChem CID | 139036050 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3,6-ditert-butyl-10-phenylacridin-9-one |
| SMILES | CC(C)(C)c1ccc2c(=O)c3ccc(C(C)(C)C)cc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H29NO/c1-26(2,3)18-12-14-21-23(16-18)28(20-10-8-7-9-11-20)24-17-19(27(4,5)6)13-15-22(24)25(21)29/h7-17H,1-6H3 |
| InChIKey | TUQNVKXKYRDLPU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|