C19H11F2NO — CID 156785373
3,6-difluoro-10-phenylacridin-9-one (PubChem CID 156785373) has the molecular formula C19H11F2NO and a molecular weight of 307.30 g/mol. Its IUPAC name is 3,6-difluoro-10-phenylacridin-9-one.
| Compound Name | 3,6-difluoro-10-phenylacridin-9-one |
|---|---|
| PubChem CID | 156785373 |
| Molecular Formula | C19H11F2NO |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3,6-difluoro-10-phenylacridin-9-one |
| SMILES | O=c1c2ccc(F)cc2n(-c2ccccc2)c2cc(F)ccc12 |
| InChI | InChI=1S/C19H11F2NO/c20-12-6-8-15-17(10-12)22(14-4-2-1-3-5-14)18-11-13(21)7-9-16(18)19(15)23/h1-11H |
| InChIKey | CIXBPRMAZYBBKT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|