C31H20N3O2+ — CID 59002279
7-oxo-5,12-diphenylquinolino[3,2-b]phenazin-7-ium-14-one (PubChem CID 59002279) has the molecular formula C31H20N3O2+ and a molecular weight of 466.52 g/mol. Its IUPAC name is 7-oxo-5,12-diphenylquinolino[3,2-b]phenazin-7-ium-14-one.
| Compound Name | 7-oxo-5,12-diphenylquinolino[3,2-b]phenazin-7-ium-14-one |
|---|---|
| PubChem CID | 59002279 |
| Molecular Formula | C31H20N3O2+ |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 7-oxo-5,12-diphenylquinolino[3,2-b]phenazin-7-ium-14-one |
| SMILES | O=c1c2ccccc2n(-c2ccccc2)c2cc3c(cc12)n(-c1ccccc1)c1ccccc1[n+]3=O |
| InChI | InChI=1S/C31H20N3O2/c35-31-23-15-7-8-16-25(23)32(21-11-3-1-4-12-21)28-20-30-29(19-24(28)31)33(22-13-5-2-6-14-22)26-17-9-10-18-27(26)34(30)36/h1-20H/q+1 |
| InChIKey | HEFXIYLYGKQQNK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 49.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|