C25H24BNO3 — CID 89182990
10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-9-one (PubChem CID 89182990) has the molecular formula C25H24BNO3 and a molecular weight of 397.28 g/mol. Its IUPAC name is 10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-9-one.
| Compound Name | 10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-9-one |
|---|---|
| PubChem CID | 89182990 |
| Molecular Formula | C25H24BNO3 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 10-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-9-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)c(=O)c2ccccc2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C25H24BNO3/c1-24(2)25(3,4)30-26(29-24)17-14-15-22-20(16-17)23(28)19-12-8-9-13-21(19)27(22)18-10-6-5-7-11-18/h5-16H,1-4H3 |
| InChIKey | LKMQLDOVKFDMLL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|