C23H23BN2O2 — CID 67094792
5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole (PubChem CID 67094792) has the molecular formula C23H23BN2O2 and a molecular weight of 370.26 g/mol. Its IUPAC name is 5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole.
| Compound Name | 5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 67094792 |
| Molecular Formula | C23H23BN2O2 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2ncccc2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H23BN2O2/c1-22(2)23(3,4)28-24(27-22)16-12-13-19-18(15-16)21-20(11-8-14-25-21)26(19)17-9-6-5-7-10-17/h5-15H,1-4H3 |
| InChIKey | HBJRRHOJQLOQKG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|