C29H27BN2O2 — CID 142725070
5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrido[3,2-b]indole (PubChem CID 142725070) has the molecular formula C29H27BN2O2 and a molecular weight of 446.36 g/mol. Its IUPAC name is 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrido[3,2-b]indole.
| Compound Name | 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 142725070 |
| Molecular Formula | C29H27BN2O2 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrido[3,2-b]indole |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-n4c5ccccc5c5ncccc54)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C29H27BN2O2/c1-28(2)29(3,4)34-30(33-28)22-15-11-20(12-16-22)21-13-17-23(18-14-21)32-25-9-6-5-8-24(25)27-26(32)10-7-19-31-27/h5-19H,1-4H3 |
| InChIKey | GBDPYSMFENLCAN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|