C31H28BN3O2 — CID 144781048
3,10-diphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-a]carbazole (PubChem CID 144781048) has the molecular formula C31H28BN3O2 and a molecular weight of 485.40 g/mol. Its IUPAC name is 3,10-diphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-a]carbazole.
| Compound Name | 3,10-diphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-a]carbazole |
|---|---|
| PubChem CID | 144781048 |
| Molecular Formula | C31H28BN3O2 |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3,10-diphenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,5-a]carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2ccc4c(cnn4-c4ccccc4)c2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C31H28BN3O2/c1-30(2)31(3,4)37-32(36-30)21-15-17-27-25(19-21)24-16-18-28-26(20-33-35(28)23-13-9-6-10-14-23)29(24)34(27)22-11-7-5-8-12-22/h5-20H,1-4H3 |
| InChIKey | DGCOSXFVKNNKKN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 41.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|