C30H34B2BrNO4 — CID 149079009
9-(4-bromophenyl)-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 149079009) has the molecular formula C30H34B2BrNO4 and a molecular weight of 574.13 g/mol. Its IUPAC name is 9-(4-bromophenyl)-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-(4-bromophenyl)-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 149079009 |
| Molecular Formula | C30H34B2BrNO4 |
| Molecular Weight | 574.13 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 9-(4-bromophenyl)-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2cc(B4OC(C)(C)C(C)(C)O4)ccc2n3-c2ccc(Br)cc2)OC1(C)C |
| InChI | InChI=1S/C30H34B2BrNO4/c1-27(2)28(3,4)36-31(35-27)19-9-15-25-23(17-19)24-18-20(32-37-29(5,6)30(7,8)38-32)10-16-26(24)34(25)22-13-11-21(33)12-14-22/h9-18H,1-8H3 |
| InChIKey | QPTKSFPSCFGKBT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.13 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|