C39H33BN4O2 — CID 145257430
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 145257430) has the molecular formula C39H33BN4O2 and a molecular weight of 600.53 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 145257430 |
| Molecular Formula | C39H33BN4O2 |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C39H33BN4O2/c1-38(2)39(3,4)46-40(45-38)29-21-23-34-32(25-29)31-24-28(20-22-33(31)44(34)30-18-12-7-13-19-30)37-42-35(26-14-8-5-9-15-26)41-36(43-37)27-16-10-6-11-17-27/h5-25H,1-4H3 |
| InChIKey | RAADSRBECBCNNP-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|