C45H35BN4O3 — CID 147372231
9-[3-[4-phenyl-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 147372231) has the molecular formula C45H35BN4O3 and a molecular weight of 690.61 g/mol. Its IUPAC name is 9-[3-[4-phenyl-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[3-[4-phenyl-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 147372231 |
| Molecular Formula | C45H35BN4O3 |
| Molecular Weight | 690.61 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 9-[3-[4-phenyl-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)oc2cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-n6c7ccccc7c7ccccc76)c5)n4)c23)OC1(C)C |
| InChI | InChI=1S/C45H35BN4O3/c1-44(2)45(3,4)53-46(52-44)30-24-25-34-39(27-30)51-38-23-13-20-35(40(34)38)43-48-41(28-14-6-5-7-15-28)47-42(49-43)29-16-12-17-31(26-29)50-36-21-10-8-18-32(36)33-19-9-11-22-37(33)50/h5-27H,1-4H3 |
| InChIKey | DJIAIZDPXHLCQV-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.61 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|