C51H38BN5O3 — CID 165166724
11-phenyl-12-[4-phenyl-6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole (PubChem CID 165166724) has the molecular formula C51H38BN5O3 and a molecular weight of 779.71 g/mol. Its IUPAC name is 11-phenyl-12-[4-phenyl-6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole.
| Compound Name | 11-phenyl-12-[4-phenyl-6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 165166724 |
| Molecular Formula | C51H38BN5O3 |
| Molecular Weight | 779.71 g/mol |
| Exact Mass | 779.31 |
| IUPAC Name | 11-phenyl-12-[4-phenyl-6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
| SMILES | CC1(C)OB(c2ccc3oc4cccc(-c5nc(-c6ccccc6)nc(-n6c7ccccc7c7ccc8c9ccccc9n(-c9ccccc9)c8c76)n5)c4c3c2)OC1(C)C |
| InChI | InChI=1S/C51H38BN5O3/c1-50(2)51(3,4)60-52(59-50)32-26-29-42-39(30-32)44-38(22-15-25-43(44)58-42)48-53-47(31-16-7-5-8-17-31)54-49(55-48)57-41-24-14-12-21-35(41)37-28-27-36-34-20-11-13-23-40(34)56(45(36)46(37)57)33-18-9-6-10-19-33/h5-30H,1-4H3 |
| InChIKey | DTFATADYVVBJPI-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 80.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.71 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|