C38H36BNO2Si — CID 140780729
3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 140780729) has the molecular formula C38H36BNO2Si and a molecular weight of 577.61 g/mol. Its IUPAC name is 3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 140780729 |
| Molecular Formula | C38H36BNO2Si |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-9-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2cc(-c4ccc5c(c4)[Si](C)(C)c4ccccc4-5)ccc2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C38H36BNO2Si/c1-37(2)38(3,4)42-39(41-37)27-18-21-34-32(24-27)31-22-25(17-20-33(31)40(34)28-12-8-7-9-13-28)26-16-19-30-29-14-10-11-15-35(29)43(5,6)36(30)23-26/h7-24H,1-6H3 |
| InChIKey | ULODXICBPGDFIT-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|