C38H31BN2O4 — CID 170683303
10-phenyl-21-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10,21-diazapentacyclo[11.9.0.03,11.04,9.014,19]docosa-1(13),2,4,6,8,11,14,16,18-nonaene-20,22-dione (PubChem CID 170683303) has the molecular formula C38H31BN2O4 and a molecular weight of 590.49 g/mol. Its IUPAC name is 10-phenyl-21-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10,21-diazapentacyclo[11.9.0.03,11.04,9.014,19]docosa-1(13),2,4,6,8,11,14,16,18-nonaene-20,22-dione.
| Compound Name | 10-phenyl-21-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10,21-diazapentacyclo[11.9.0.03,11.04,9.014,19]docosa-1(13),2,4,6,8,11,14,16,18-nonaene-20,22-dione |
|---|---|
| PubChem CID | 170683303 |
| Molecular Formula | C38H31BN2O4 |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 10-phenyl-21-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10,21-diazapentacyclo[11.9.0.03,11.04,9.014,19]docosa-1(13),2,4,6,8,11,14,16,18-nonaene-20,22-dione |
| SMILES | CC1(C)OB(c2ccc(-n3c(=O)c4ccccc4c4cc5c(cc4c3=O)c3ccccc3n5-c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C38H31BN2O4/c1-37(2)38(3,4)45-39(44-37)24-18-20-26(21-19-24)41-35(42)29-16-9-8-14-27(29)30-23-34-31(22-32(30)36(41)43)28-15-10-11-17-33(28)40(34)25-12-6-5-7-13-25/h5-23H,1-4H3 |
| InChIKey | HUQZPJKURWVZMW-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|