C30H26BNO2S — CID 170671268
9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]carbazole (PubChem CID 170671268) has the molecular formula C30H26BNO2S and a molecular weight of 475.42 g/mol. Its IUPAC name is 9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]carbazole.
| Compound Name | 9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]carbazole |
|---|---|
| PubChem CID | 170671268 |
| Molecular Formula | C30H26BNO2S |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)sc2cc(-n4c5ccccc5c5ccccc54)ccc23)OC1(C)C |
| InChI | InChI=1S/C30H26BNO2S/c1-29(2)30(3,4)34-31(33-29)19-13-15-23-24-16-14-20(18-28(24)35-27(23)17-19)32-25-11-7-5-9-21(25)22-10-6-8-12-26(22)32/h5-18H,1-4H3 |
| InChIKey | JXIZTNAMAYPZJY-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|