C33H34BNO2 — CID 144896856
9-(9,9-dimethylfluoren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;molecular hydrogen (PubChem CID 144896856) has the molecular formula C33H34BNO2 and a molecular weight of 487.45 g/mol. Its IUPAC name is 9-(9,9-dimethylfluoren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;molecular hydrogen.
| Compound Name | 9-(9,9-dimethylfluoren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;molecular hydrogen |
|---|---|
| PubChem CID | 144896856 |
| Molecular Formula | C33H34BNO2 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 9-(9,9-dimethylfluoren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;molecular hydrogen |
| SMILES | CC1(C)c2ccccc2-c2cc(-n3c4ccccc4c4ccc(B5OC(C)(C)C(C)(C)O5)cc43)ccc21.[H][H] |
| InChI | InChI=1S/C33H32BNO2.H2/c1-31(2)27-13-9-7-11-23(27)26-20-22(16-18-28(26)31)35-29-14-10-8-12-24(29)25-17-15-21(19-30(25)35)34-36-32(3,4)33(5,6)37-34;/h7-20H,1-6H3;1H |
| InChIKey | CBHHZWAFYQACLS-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|