C22H22BNO2S — CID 162691557
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-thiophen-2-ylcarbazole (PubChem CID 162691557) has the molecular formula C22H22BNO2S and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-thiophen-2-ylcarbazole.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-thiophen-2-ylcarbazole |
|---|---|
| PubChem CID | 162691557 |
| Molecular Formula | C22H22BNO2S |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-thiophen-2-ylcarbazole |
| SMILES | CC1(C)OB(c2ccc3c4ccccc4n(-c4cccs4)c3c2)OC1(C)C |
| InChI | InChI=1S/C22H22BNO2S/c1-21(2)22(3,4)26-23(25-21)15-11-12-17-16-8-5-6-9-18(16)24(19(17)14-15)20-10-7-13-27-20/h5-14H,1-4H3 |
| InChIKey | FVHGVDYAQSKTSV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|