C32H39B2NO4 — CID 176917203
5,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene;ethane (PubChem CID 176917203) has the molecular formula C32H39B2NO4 and a molecular weight of 523.29 g/mol. Its IUPAC name is 5,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene;ethane.
| Compound Name | 5,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene;ethane |
|---|---|
| PubChem CID | 176917203 |
| Molecular Formula | C32H39B2NO4 |
| Molecular Weight | 523.29 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | 5,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene;ethane |
| SMILES | CC.CC1(C)OB(c2ccc3c(c2)c2cc(B4OC(C)(C)C(C)(C)O4)cc4c5ccccc5n3c42)OC1(C)C |
| InChI | InChI=1S/C30H33B2NO4.C2H6/c1-27(2)28(3,4)35-31(34-27)18-13-14-25-21(15-18)23-17-19(32-36-29(5,6)30(7,8)37-32)16-22-20-11-9-10-12-24(20)33(25)26(22)23;1-2/h9-17H,1-8H3;1-2H3 |
| InChIKey | FLOUABXHPNARFX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 41.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.29 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|