C30H34B2O4 — CID 58174852
4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triphenylen-2-yl]-1,3,2-dioxaborolane (PubChem CID 58174852) has the molecular formula C30H34B2O4 and a molecular weight of 480.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triphenylen-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triphenylen-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58174852 |
| Molecular Formula | C30H34B2O4 |
| Molecular Weight | 480.22 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triphenylen-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c4ccc(B5OC(C)(C)C(C)(C)O5)cc4c4ccccc4c3c2)OC1(C)C |
| InChI | InChI=1S/C30H34B2O4/c1-27(2)28(3,4)34-31(33-27)19-13-15-23-24-16-14-20(32-35-29(5,6)30(7,8)36-32)18-26(24)22-12-10-9-11-21(22)25(23)17-19/h9-18H,1-8H3 |
| InChIKey | PGKQJNOISHJIBI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.22 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|