C40H39BO2 — CID 58501190
2-[6,12-bis(2,6-dimethylphenyl)chrysen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 58501190) has the molecular formula C40H39BO2 and a molecular weight of 562.56 g/mol. Its IUPAC name is 2-[6,12-bis(2,6-dimethylphenyl)chrysen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6,12-bis(2,6-dimethylphenyl)chrysen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58501190 |
| Molecular Formula | C40H39BO2 |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 2-[6,12-bis(2,6-dimethylphenyl)chrysen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cccc(C)c1-c1cc2c3cc(B4OC(C)(C)C(C)(C)O4)ccc3c(-c3c(C)cccc3C)cc2c2ccccc12 |
| InChI | InChI=1S/C40H39BO2/c1-24-13-11-14-25(2)37(24)35-23-34-32-21-28(41-42-39(5,6)40(7,8)43-41)19-20-31(32)36(38-26(3)15-12-16-27(38)4)22-33(34)29-17-9-10-18-30(29)35/h9-23H,1-8H3 |
| InChIKey | ADQKYLLDOLNQPO-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|