C20H23BO2P2 — CID 89344875
[10-phosphanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-yl]phosphane (PubChem CID 89344875) has the molecular formula C20H23BO2P2 and a molecular weight of 368.16 g/mol. Its IUPAC name is [10-phosphanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-yl]phosphane.
| Compound Name | [10-phosphanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-yl]phosphane |
|---|---|
| PubChem CID | 89344875 |
| Molecular Formula | C20H23BO2P2 |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [10-phosphanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenanthren-9-yl]phosphane |
| SMILES | CC1(C)OB(c2ccc3c(c2)c(P)c(P)c2ccccc23)OC1(C)C |
| InChI | InChI=1S/C20H23BO2P2/c1-19(2)20(3,4)23-21(22-19)12-9-10-14-13-7-5-6-8-15(13)17(24)18(25)16(14)11-12/h5-11H,24-25H2,1-4H3 |
| InChIKey | JEJOBIKMFUOZNE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|