C19H19BO4 — CID 140838592
9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]chromen-6-one (PubChem CID 140838592) has the molecular formula C19H19BO4 and a molecular weight of 322.17 g/mol. Its IUPAC name is 9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]chromen-6-one.
| Compound Name | 9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 140838592 |
| Molecular Formula | C19H19BO4 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]chromen-6-one |
| SMILES | CC1(C)OB(c2ccc3c(=O)oc4ccccc4c3c2)OC1(C)C |
| InChI | InChI=1S/C19H19BO4/c1-18(2)19(3,4)24-20(23-18)12-9-10-14-15(11-12)13-7-5-6-8-16(13)22-17(14)21/h5-11H,1-4H3 |
| InChIKey | WEFQLNZNKSQSJY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|