C24H30B2O5 — CID 153437831
4,4,5,5-tetramethyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane (PubChem CID 153437831) has the molecular formula C24H30B2O5 and a molecular weight of 420.12 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153437831 |
| Molecular Formula | C24H30B2O5 |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3oc4cccc(B5OC(C)(C)C(C)(C)O5)c4c3c2)OC1(C)C |
| InChI | InChI=1S/C24H30B2O5/c1-21(2)22(3,4)29-25(28-21)15-12-13-18-16(14-15)20-17(10-9-11-19(20)27-18)26-30-23(5,6)24(7,8)31-26/h9-14H,1-8H3 |
| InChIKey | NZMVHAPSIMFVNK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|