C34H27BN2O4 — CID 160968056
4-phenyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 160968056) has the molecular formula C34H27BN2O4 and a molecular weight of 538.41 g/mol. Its IUPAC name is 4-phenyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-phenyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 160968056 |
| Molecular Formula | C34H27BN2O4 |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-phenyl-2-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | CC1(C)OB(c2ccc3oc4cccc(-c5nc(-c6ccccc6)c6oc7ccccc7c6n5)c4c3c2)OC1(C)C |
| InChI | InChI=1S/C34H27BN2O4/c1-33(2)34(3,4)41-35(40-33)21-17-18-26-24(19-21)28-23(14-10-16-27(28)38-26)32-36-29(20-11-6-5-7-12-20)31-30(37-32)22-13-8-9-15-25(22)39-31/h5-19H,1-4H3 |
| InChIKey | CHXUGEFXBUAYJO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 70.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|