C39H33BN3O3+ — CID 142509831
2-phenyl-6-(3-phenylphenyl)-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-1-ium (PubChem CID 142509831) has the molecular formula C39H33BN3O3+ and a molecular weight of 602.52 g/mol. Its IUPAC name is 2-phenyl-6-(3-phenylphenyl)-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-1-ium.
| Compound Name | 2-phenyl-6-(3-phenylphenyl)-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 142509831 |
| Molecular Formula | C39H33BN3O3+ |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 2-phenyl-6-(3-phenylphenyl)-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazin-1-ium |
| SMILES | CC1(C)OB(c2ccc3oc4cccc(-c5nc(-c6ccccc6)[nH+]c(-c6cccc(-c7ccccc7)c6)n5)c4c3c2)OC1(C)C |
| InChI | InChI=1S/C39H32BN3O3/c1-38(2)39(3,4)46-40(45-38)29-21-22-32-31(24-29)34-30(19-12-20-33(34)44-32)37-42-35(26-15-9-6-10-16-26)41-36(43-37)28-18-11-17-27(23-28)25-13-7-5-8-14-25/h5-24H,1-4H3/p+1 |
| InChIKey | KIEHRMSTVADXPM-UHFFFAOYSA-O |
| XLogP | 8.16 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|