C24H22BO2+ — CID 140705394
4,5,5-trimethyl-4-methyl-2-triphenylen-2-yl-1,3,2-dioxaborolane (PubChem CID 140705394) has the molecular formula C24H22BO2+ and a molecular weight of 353.25 g/mol. Its IUPAC name is 4,5,5-trimethyl-4-methyl-2-triphenylen-2-yl-1,3,2-dioxaborolane.
| Compound Name | 4,5,5-trimethyl-4-methyl-2-triphenylen-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140705394 |
| Molecular Formula | C24H22BO2+ |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 4,5,5-trimethyl-4-methyl-2-triphenylen-2-yl-1,3,2-dioxaborolane |
| SMILES | [CH2+]C1(C)OB(c2ccc3c4ccccc4c4ccccc4c3c2)OC1(C)C |
| InChI | InChI=1S/C24H22BO2/c1-23(2)24(3,4)27-25(26-23)16-13-14-21-19-11-6-5-9-17(19)18-10-7-8-12-20(18)22(21)15-16/h5-15H,1H2,2-4H3/q+1 |
| InChIKey | XHESIWJEZMPGJT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|