C46H48N2O2 — CID 168823353
3,10-ditert-butyl-5,12-bis(4-propan-2-ylphenyl)quinolino[2,3-b]acridine-7,14-dione (PubChem CID 168823353) has the molecular formula C46H48N2O2 and a molecular weight of 660.90 g/mol. Its IUPAC name is 3,10-ditert-butyl-5,12-bis(4-propan-2-ylphenyl)quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 3,10-ditert-butyl-5,12-bis(4-propan-2-ylphenyl)quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 168823353 |
| Molecular Formula | C46H48N2O2 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 3,10-ditert-butyl-5,12-bis(4-propan-2-ylphenyl)quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CC(C)c1ccc(-n2c3cc(C(C)(C)C)ccc3c(=O)c3cc4c(cc32)c(=O)c2ccc(C(C)(C)C)cc2n4-c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C46H48N2O2/c1-27(2)29-11-17-33(18-12-29)47-39-23-31(45(5,6)7)15-21-35(39)43(49)37-26-42-38(25-41(37)47)44(50)36-22-16-32(46(8,9)10)24-40(36)48(42)34-19-13-30(14-20-34)28(3)4/h11-28H,1-10H3 |
| InChIKey | IZQNLQLGGXBDRX-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|