C26H29NS — CID 170187898
2-tert-butyl-7-(2-methylsulfanylpropan-2-yl)-9-phenylcarbazole (PubChem CID 170187898) has the molecular formula C26H29NS and a molecular weight of 387.59 g/mol. Its IUPAC name is 2-tert-butyl-7-(2-methylsulfanylpropan-2-yl)-9-phenylcarbazole.
| Compound Name | 2-tert-butyl-7-(2-methylsulfanylpropan-2-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 170187898 |
| Molecular Formula | C26H29NS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-tert-butyl-7-(2-methylsulfanylpropan-2-yl)-9-phenylcarbazole |
| SMILES | CSC(C)(C)c1ccc2c3ccc(C(C)(C)C)cc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H29NS/c1-25(2,3)18-12-14-21-22-15-13-19(26(4,5)28-6)17-24(22)27(23(21)16-18)20-10-8-7-9-11-20/h7-17H,1-6H3 |
| InChIKey | VSSIBKVSZMAQQF-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |