C30H31BrN2 — CID 118642287
2-(4-bromophenyl)-4,6-bis(4-tert-butylphenyl)pyrimidine (PubChem CID 118642287) has the molecular formula C30H31BrN2 and a molecular weight of 499.50 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,6-bis(4-tert-butylphenyl)pyrimidine.
| Compound Name | 2-(4-bromophenyl)-4,6-bis(4-tert-butylphenyl)pyrimidine |
|---|---|
| PubChem CID | 118642287 |
| Molecular Formula | C30H31BrN2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-(4-bromophenyl)-4,6-bis(4-tert-butylphenyl)pyrimidine |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C30H31BrN2/c1-29(2,3)23-13-7-20(8-14-23)26-19-27(21-9-15-24(16-10-21)30(4,5)6)33-28(32-26)22-11-17-25(31)18-12-22/h7-19H,1-6H3 |
| InChIKey | RJSLSAWTQRPYCS-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |