C23H14BrN3 — CID 44542251
4-[6-(4-bromophenyl)-2-phenylpyrimidin-4-yl]benzonitrile (PubChem CID 44542251) has the molecular formula C23H14BrN3 and a molecular weight of 412.29 g/mol. Its IUPAC name is 4-[6-(4-bromophenyl)-2-phenylpyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[6-(4-bromophenyl)-2-phenylpyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 44542251 |
| Molecular Formula | C23H14BrN3 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 4-[6-(4-bromophenyl)-2-phenylpyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(Br)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H14BrN3/c24-20-12-10-18(11-13-20)22-14-21(17-8-6-16(15-25)7-9-17)26-23(27-22)19-4-2-1-3-5-19/h1-14H |
| InChIKey | XRAKIPDRVOFFRN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |