C42H26N4 — CID 170032601
4-[2-(4-cyanophenyl)-4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]benzonitrile (PubChem CID 170032601) has the molecular formula C42H26N4 and a molecular weight of 586.70 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 4-[2-(4-cyanophenyl)-4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170032601 |
| Molecular Formula | C42H26N4 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C42H26N4/c43-27-29-11-15-32(16-12-29)38-24-23-37(25-39(38)33-17-13-30(28-44)14-18-33)31-19-21-35(22-20-31)41-26-40(34-7-3-1-4-8-34)45-42(46-41)36-9-5-2-6-10-36/h1-26H |
| InChIKey | BMUNYTJWVUWPBT-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |