C57H35N3 — CID 165376116
4-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]fluoranthen-3-yl]benzonitrile (PubChem CID 165376116) has the molecular formula C57H35N3 and a molecular weight of 761.93 g/mol. Its IUPAC name is 4-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]fluoranthen-3-yl]benzonitrile.
| Compound Name | 4-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]fluoranthen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 165376116 |
| Molecular Formula | C57H35N3 |
| Molecular Weight | 761.93 g/mol |
| Exact Mass | 761.28 |
| IUPAC Name | 4-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]fluoranthen-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c4c(ccc(-c5ccc(-c6cc(-c7ccc(-c8ccccc8)cc7)nc(-c7ccc(-c8ccccc8)cc7)n6)cc5)c24)-c2ccccc2-3)cc1 |
| InChI | InChI=1S/C57H35N3/c58-36-37-15-17-42(18-16-37)47-31-33-51-49-13-7-8-14-50(49)52-34-32-48(55(47)56(51)52)43-23-27-45(28-24-43)54-35-53(44-25-19-40(20-26-44)38-9-3-1-4-10-38)59-57(60-54)46-29-21-41(22-30-46)39-11-5-2-6-12-39/h1-35H |
| InChIKey | KEKRQBNGSIBYAE-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.93 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |