C52H42N4 — CID 156575664
4-[4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]fluoranthen-3-yl]benzonitrile (PubChem CID 156575664) has the molecular formula C52H42N4 and a molecular weight of 722.94 g/mol. Its IUPAC name is 4-[4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]fluoranthen-3-yl]benzonitrile.
| Compound Name | 4-[4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]fluoranthen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 156575664 |
| Molecular Formula | C52H42N4 |
| Molecular Weight | 722.94 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | 4-[4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]fluoranthen-3-yl]benzonitrile |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(-c4ccc5c6c(ccc(-c7ccc(C#N)cc7)c46)-c4ccccc4-5)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C52H42N4/c1-51(2,3)38-23-19-36(20-24-38)49-54-48(55-50(56-49)37-21-25-39(26-22-37)52(4,5)6)35-17-15-34(16-18-35)41-28-30-45-43-10-8-7-9-42(43)44-29-27-40(46(41)47(44)45)33-13-11-32(31-53)12-14-33/h7-30H,1-6H3 |
| InChIKey | KTZWROVEYFIZEZ-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.94 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |