C45H29N3 — CID 134317940
3-[4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile (PubChem CID 134317940) has the molecular formula C45H29N3 and a molecular weight of 611.75 g/mol. Its IUPAC name is 3-[4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 134317940 |
| Molecular Formula | C45H29N3 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | 3-[4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(-c3ccc(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C45H29N3/c46-30-31-10-9-15-38(28-31)32-18-20-33(21-19-32)39-26-27-40(42-17-8-7-16-41(39)42)34-22-24-36(25-23-34)44-29-43(35-11-3-1-4-12-35)47-45(48-44)37-13-5-2-6-14-37/h1-29H |
| InChIKey | ACQFWJUOBYKCJT-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |