C26H31N — CID 176593215
N,2-bis(4-tert-butylphenyl)aniline (PubChem CID 176593215) has the molecular formula C26H31N and a molecular weight of 357.54 g/mol. Its IUPAC name is N,2-bis(4-tert-butylphenyl)aniline.
| Compound Name | N,2-bis(4-tert-butylphenyl)aniline |
|---|---|
| PubChem CID | 176593215 |
| Molecular Formula | C26H31N |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | N,2-bis(4-tert-butylphenyl)aniline |
| SMILES | CC(C)(C)c1ccc(Nc2ccccc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H31N/c1-25(2,3)20-13-11-19(12-14-20)23-9-7-8-10-24(23)27-22-17-15-21(16-18-22)26(4,5)6/h7-18,27H,1-6H3 |
| InChIKey | YJKFJAPMFYIYNQ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |