C31H33N — CID 162507884
N-(4-tert-butylphenyl)-2-phenyl-4-(2-phenylpropan-2-yl)aniline (PubChem CID 162507884) has the molecular formula C31H33N and a molecular weight of 419.61 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-phenyl-4-(2-phenylpropan-2-yl)aniline.
| Compound Name | N-(4-tert-butylphenyl)-2-phenyl-4-(2-phenylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 162507884 |
| Molecular Formula | C31H33N |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-phenyl-4-(2-phenylpropan-2-yl)aniline |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(C(C)(C)c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H33N/c1-30(2,3)24-16-19-27(20-17-24)32-29-21-18-26(22-28(29)23-12-8-6-9-13-23)31(4,5)25-14-10-7-11-15-25/h6-22,32H,1-5H3 |
| InChIKey | RVMMYINEGNKCEV-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |