C34H32N2 — CID 164550748
1-N-(4-tert-butyl-2-phenylphenyl)-3-N,3-N-diphenylbenzene-1,3-diamine (PubChem CID 164550748) has the molecular formula C34H32N2 and a molecular weight of 468.64 g/mol. Its IUPAC name is 1-N-(4-tert-butyl-2-phenylphenyl)-3-N,3-N-diphenylbenzene-1,3-diamine.
| Compound Name | 1-N-(4-tert-butyl-2-phenylphenyl)-3-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 164550748 |
| Molecular Formula | C34H32N2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-N-(4-tert-butyl-2-phenylphenyl)-3-N,3-N-diphenylbenzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(Nc2cccc(N(c3ccccc3)c3ccccc3)c2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C34H32N2/c1-34(2,3)27-22-23-33(32(24-27)26-14-7-4-8-15-26)35-28-16-13-21-31(25-28)36(29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-25,35H,1-3H3 |
| InChIKey | IFMHTXNWAZBVCX-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |