C31H31N — CID 164550755
N-(4-tert-butyl-2-phenylphenyl)-9,9-dimethylfluoren-3-amine (PubChem CID 164550755) has the molecular formula C31H31N and a molecular weight of 417.60 g/mol. Its IUPAC name is N-(4-tert-butyl-2-phenylphenyl)-9,9-dimethylfluoren-3-amine.
| Compound Name | N-(4-tert-butyl-2-phenylphenyl)-9,9-dimethylfluoren-3-amine |
|---|---|
| PubChem CID | 164550755 |
| Molecular Formula | C31H31N |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-(4-tert-butyl-2-phenylphenyl)-9,9-dimethylfluoren-3-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ccc3c(c2)-c2ccccc2C3(C)C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C31H31N/c1-30(2,3)22-15-18-29(25(19-22)21-11-7-6-8-12-21)32-23-16-17-28-26(20-23)24-13-9-10-14-27(24)31(28,4)5/h6-20,32H,1-5H3 |
| InChIKey | YGWVJRVVXTVRBS-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |