C30H27NO — CID 171429896
N-[4-(1-benzofuran-2-yl)phenyl]-4-tert-butyl-2-phenylaniline (PubChem CID 171429896) has the molecular formula C30H27NO and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)phenyl]-4-tert-butyl-2-phenylaniline.
| Compound Name | N-[4-(1-benzofuran-2-yl)phenyl]-4-tert-butyl-2-phenylaniline |
|---|---|
| PubChem CID | 171429896 |
| Molecular Formula | C30H27NO |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)phenyl]-4-tert-butyl-2-phenylaniline |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(-c3cc4ccccc4o3)cc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C30H27NO/c1-30(2,3)24-15-18-27(26(20-24)21-9-5-4-6-10-21)31-25-16-13-22(14-17-25)29-19-23-11-7-8-12-28(23)32-29/h4-20,31H,1-3H3 |
| InChIKey | BDRXDHWIESVLKY-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |