About 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran
2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran (PubChem CID 59390421) has the molecular formula C54H50O
and a molecular weight of 714.99 g/mol. Its IUPAC name is 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran.
Molecular Properties
| Compound Name | 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran |
| PubChem CID | 59390421 |
| Molecular Formula | C54H50O |
| Molecular Weight | 714.99 g/mol |
| Exact Mass | 714.39 |
| IUPAC Name | 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c3ccc4c(-c5cc6ccccc6o5)cc(-c5ccc(C(C)(C)C)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C54H50O/c1-52(2,3)37-20-14-33(15-21-37)44-31-45(34-16-22-38(23-17-34)53(4,5)6)41-28-29-43-47(49-30-36-12-10-11-13-48(36)55-49)32-46(42-27-26-40(44)50(41)51(42)43)35-18-24-39(25-19-35)54(7,8)9/h10-32H,1-9H3 |
| InChIKey | KFXOUCXFNDRQBY-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 714.99 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran?
The IUPAC name of 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran (CID 59390421) is 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran.
What is the SMILES notation for 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran?
The canonical SMILES for 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran is CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c3ccc4c(-c5cc6ccccc6o5)cc(-c5ccc(C(C)(C)C)cc5)c5ccc2c3c54)cc1.
What is the InChIKey of 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran?
The InChIKey is KFXOUCXFNDRQBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H50O/c1-52(2,3)37-20-14-33(15-21-37)44-31-45(34-16-22-38(23-17-34)53(4,5)6)41-28-29-43-47(49-30-36-12-10-11-13-48(36)55-49)32-46(42-27-26-40(44)50(41)51(42)43)35-18-24-39(25-19-35)54(7,8)9/h10-32H,1-9H3.
What are the key properties of 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran?
2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran has a molecular weight of 714.99 g/mol, XLogP of 15.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran is sourced from PubChem (CID 59390421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).