C54H50O — CID 59390421
2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran (PubChem CID 59390421) has the molecular formula C54H50O and a molecular weight of 714.99 g/mol. Its IUPAC name is 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran.
| Compound Name | 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran |
|---|---|
| PubChem CID | 59390421 |
| Molecular Formula | C54H50O |
| Molecular Weight | 714.99 g/mol |
| Exact Mass | 714.39 |
| IUPAC Name | 2-[3,6,8-tris(4-tert-butylphenyl)pyren-1-yl]-1-benzofuran |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c3ccc4c(-c5cc6ccccc6o5)cc(-c5ccc(C(C)(C)C)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C54H50O/c1-52(2,3)37-20-14-33(15-21-37)44-31-45(34-16-22-38(23-17-34)53(4,5)6)41-28-29-43-47(49-30-36-12-10-11-13-48(36)55-49)32-46(42-27-26-40(44)50(41)51(42)43)35-18-24-39(25-19-35)54(7,8)9/h10-32H,1-9H3 |
| InChIKey | KFXOUCXFNDRQBY-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.99 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|