C34H27NO2S — CID 171604639
N-[3,5-bis(1-benzofuran-2-yl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine (PubChem CID 171604639) has the molecular formula C34H27NO2S and a molecular weight of 513.66 g/mol. Its IUPAC name is N-[3,5-bis(1-benzofuran-2-yl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine.
| Compound Name | N-[3,5-bis(1-benzofuran-2-yl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 171604639 |
| Molecular Formula | C34H27NO2S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[3,5-bis(1-benzofuran-2-yl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine |
| SMILES | CC(C)(C)c1ccc2scc(Nc3cc(-c4cc5ccccc5o4)cc(-c4cc5ccccc5o4)c3)c2c1 |
| InChI | InChI=1S/C34H27NO2S/c1-34(2,3)25-12-13-33-27(19-25)28(20-38-33)35-26-15-23(31-17-21-8-4-6-10-29(21)36-31)14-24(16-26)32-18-22-9-5-7-11-30(22)37-32/h4-20,35H,1-3H3 |
| InChIKey | AUDJLPYAQOUXDH-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 38.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |