C38H43NS — CID 176593180
N-[2,6-bis(4-tert-butylphenyl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine (PubChem CID 176593180) has the molecular formula C38H43NS and a molecular weight of 545.84 g/mol. Its IUPAC name is N-[2,6-bis(4-tert-butylphenyl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine.
| Compound Name | N-[2,6-bis(4-tert-butylphenyl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 176593180 |
| Molecular Formula | C38H43NS |
| Molecular Weight | 545.84 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | N-[2,6-bis(4-tert-butylphenyl)phenyl]-5-tert-butyl-1-benzothiophen-3-amine |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3ccc(C(C)(C)C)cc3)c2Nc2csc3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C38H43NS/c1-36(2,3)27-17-13-25(14-18-27)30-11-10-12-31(26-15-19-28(20-16-26)37(4,5)6)35(30)39-33-24-40-34-22-21-29(23-32(33)34)38(7,8)9/h10-24,39H,1-9H3 |
| InChIKey | VQXNZZYSPFYOHJ-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.84 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |