C30H30N2O2 — CID 177078220
2-[3,5-bis(trideuteriomethyl)phenyl]-6-(4-tert-butylphenyl)-N-(2-nitrophenyl)aniline (PubChem CID 177078220) has the molecular formula C30H30N2O2 and a molecular weight of 456.62 g/mol. Its IUPAC name is 2-[3,5-bis(trideuteriomethyl)phenyl]-6-(4-tert-butylphenyl)-N-(2-nitrophenyl)aniline.
| Compound Name | 2-[3,5-bis(trideuteriomethyl)phenyl]-6-(4-tert-butylphenyl)-N-(2-nitrophenyl)aniline |
|---|---|
| PubChem CID | 177078220 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 2-[3,5-bis(trideuteriomethyl)phenyl]-6-(4-tert-butylphenyl)-N-(2-nitrophenyl)aniline |
| SMILES | [2H]C([2H])([2H])c1cc(-c2cccc(-c3ccc(C(C)(C)C)cc3)c2Nc2ccccc2[N+](=O)[O-])cc(C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C30H30N2O2/c1-20-17-21(2)19-23(18-20)26-10-8-9-25(22-13-15-24(16-14-22)30(3,4)5)29(26)31-27-11-6-7-12-28(27)32(33)34/h6-19,31H,1-5H3/i1D3,2D3 |
| InChIKey | KFHOINAKEVLIER-WFGJKAKNSA-N |
| XLogP | 8.59 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|