C30H30N2O2 — CID 164794986
N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline (PubChem CID 164794986) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline.
| Compound Name | N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 164794986 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline |
| SMILES | CC(C)(c1ccccc1)c1cccc(C(C)(C)c2ccccc2)c1Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H30N2O2/c1-29(2,22-14-7-5-8-15-22)24-18-13-19-25(30(3,4)23-16-9-6-10-17-23)28(24)31-26-20-11-12-21-27(26)32(33)34/h5-21,31H,1-4H3 |
| InChIKey | QOAHVOKZAUFHGO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|