C60H61IN4O4 — CID 164996857
2,6-bis(2-phenylpropan-2-yl)aniline;1-iodo-2-nitrobenzene;N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline (PubChem CID 164996857) has the molecular formula C60H61IN4O4 and a molecular weight of 1029.08 g/mol. Its IUPAC name is 2,6-bis(2-phenylpropan-2-yl)aniline;1-iodo-2-nitrobenzene;N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline.
| Compound Name | 2,6-bis(2-phenylpropan-2-yl)aniline;1-iodo-2-nitrobenzene;N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 164996857 |
| Molecular Formula | C60H61IN4O4 |
| Molecular Weight | 1029.08 g/mol |
| Exact Mass | 1028.37 |
| IUPAC Name | 2,6-bis(2-phenylpropan-2-yl)aniline;1-iodo-2-nitrobenzene;N-(2-nitrophenyl)-2,6-bis(2-phenylpropan-2-yl)aniline |
| SMILES | CC(C)(c1ccccc1)c1cccc(C(C)(C)c2ccccc2)c1N.CC(C)(c1ccccc1)c1cccc(C(C)(C)c2ccccc2)c1Nc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1I |
| InChI | InChI=1S/C30H30N2O2.C24H27N.C6H4INO2/c1-29(2,22-14-7-5-8-15-22)24-18-13-19-25(30(3,4)23-16-9-6-10-17-23)28(24)31-26-20-11-12-21-27(26)32(33)34;1-23(2,18-12-7-5-8-13-18)20-16-11-17-21(22(20)25)24(3,4)19-14-9-6-10-15-19;7-5-3-1-2-4-6(5)8(9)10/h5-21,31H,1-4H3;5-17H,25H2,1-4H3;1-4H |
| InChIKey | HREAFBCNPPUPRD-UHFFFAOYSA-N |
| XLogP | 16.11 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.08 |
| LogP ≤ 5 | 16.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|