C16H16Br2N2O2 — CID 170690718
2,6-dibromo-4-tert-butyl-N-(2-nitrophenyl)aniline (PubChem CID 170690718) has the molecular formula C16H16Br2N2O2 and a molecular weight of 428.12 g/mol. Its IUPAC name is 2,6-dibromo-4-tert-butyl-N-(2-nitrophenyl)aniline.
| Compound Name | 2,6-dibromo-4-tert-butyl-N-(2-nitrophenyl)aniline |
|---|---|
| PubChem CID | 170690718 |
| Molecular Formula | C16H16Br2N2O2 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 2,6-dibromo-4-tert-butyl-N-(2-nitrophenyl)aniline |
| SMILES | CC(C)(C)c1cc(Br)c(Nc2ccccc2[N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C16H16Br2N2O2/c1-16(2,3)10-8-11(17)15(12(18)9-10)19-13-6-4-5-7-14(13)20(21)22/h4-9,19H,1-3H3 |
| InChIKey | HZAFAUXWSKFULF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|