About 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline
4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline (PubChem CID 164786582) has the molecular formula C28H26N2O2
and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline |
| PubChem CID | 164786582 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(Nc2ccccc2[N+](=O)[O-])c(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H26N2O2/c1-28(2,3)22-18-23(20-12-6-4-7-13-20)27(24(19-22)21-14-8-5-9-15-21)29-25-16-10-11-17-26(25)30(31)32/h4-19,29H,1-3H3 |
| InChIKey | NFEHFLCDIGJVHE-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline?
The IUPAC name of 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline (CID 164786582) is 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline.
What is the SMILES notation for 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline?
The canonical SMILES for 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline is CC(C)(C)c1cc(-c2ccccc2)c(Nc2ccccc2[N+](=O)[O-])c(-c2ccccc2)c1.
What is the InChIKey of 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline?
The InChIKey is NFEHFLCDIGJVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O2/c1-28(2,3)22-18-23(20-12-6-4-7-13-20)27(24(19-22)21-14-8-5-9-15-21)29-25-16-10-11-17-26(25)30(31)32/h4-19,29H,1-3H3.
What are the key properties of 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline?
4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline has a molecular weight of 422.53 g/mol, XLogP of 7.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(2-nitrophenyl)-2,6-diphenylaniline is sourced from PubChem (CID 164786582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).