About carbamic acid;N-methyl-2-nitroaniline
carbamic acid;N-methyl-2-nitroaniline (PubChem CID 175546963) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is carbamic acid;N-methyl-2-nitroaniline.
Molecular Properties
| Compound Name | carbamic acid;N-methyl-2-nitroaniline |
| PubChem CID | 175546963 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | carbamic acid;N-methyl-2-nitroaniline |
| SMILES | CNc1ccccc1[N+](=O)[O-].NC(=O)O |
| InChI | InChI=1S/C7H8N2O2.CH3NO2/c1-8-6-4-2-3-5-7(6)9(10)11;2-1(3)4/h2-5,8H,1H3;2H2,(H,3,4) |
| InChIKey | QGYTYVKDVUYLPD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;N-methyl-2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;N-methyl-2-nitroaniline?
The IUPAC name of carbamic acid;N-methyl-2-nitroaniline (CID 175546963) is carbamic acid;N-methyl-2-nitroaniline.
What is the SMILES notation for carbamic acid;N-methyl-2-nitroaniline?
The canonical SMILES for carbamic acid;N-methyl-2-nitroaniline is CNc1ccccc1[N+](=O)[O-].NC(=O)O.
What is the InChIKey of carbamic acid;N-methyl-2-nitroaniline?
The InChIKey is QGYTYVKDVUYLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.CH3NO2/c1-8-6-4-2-3-5-7(6)9(10)11;2-1(3)4/h2-5,8H,1H3;2H2,(H,3,4).
What are the key properties of carbamic acid;N-methyl-2-nitroaniline?
carbamic acid;N-methyl-2-nitroaniline has a molecular weight of 213.19 g/mol, XLogP of 1.26, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;N-methyl-2-nitroaniline is sourced from PubChem (CID 175546963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).