About azane;carbamic acid;(2-nitrophenyl)-phenylmethanone
azane;carbamic acid;(2-nitrophenyl)-phenylmethanone (PubChem CID 174845274) has the molecular formula C14H15N3O5
and a molecular weight of 305.29 g/mol. Its IUPAC name is azane;carbamic acid;(2-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | azane;carbamic acid;(2-nitrophenyl)-phenylmethanone |
| PubChem CID | 174845274 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | azane;carbamic acid;(2-nitrophenyl)-phenylmethanone |
| SMILES | N.NC(=O)O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9NO3.CH3NO2.H3N/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;2-1(3)4;/h1-9H;2H2,(H,3,4);1H3 |
| InChIKey | ISCGPKMQSCGQPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 158.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;carbamic acid;(2-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbamic acid;(2-nitrophenyl)-phenylmethanone?
The IUPAC name of azane;carbamic acid;(2-nitrophenyl)-phenylmethanone (CID 174845274) is azane;carbamic acid;(2-nitrophenyl)-phenylmethanone.
What is the SMILES notation for azane;carbamic acid;(2-nitrophenyl)-phenylmethanone?
The canonical SMILES for azane;carbamic acid;(2-nitrophenyl)-phenylmethanone is N.NC(=O)O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of azane;carbamic acid;(2-nitrophenyl)-phenylmethanone?
The InChIKey is ISCGPKMQSCGQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.CH3NO2.H3N/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;2-1(3)4;/h1-9H;2H2,(H,3,4);1H3.
What are the key properties of azane;carbamic acid;(2-nitrophenyl)-phenylmethanone?
azane;carbamic acid;(2-nitrophenyl)-phenylmethanone has a molecular weight of 305.29 g/mol, XLogP of 2.61, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbamic acid;(2-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 174845274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).