About methanimine;(2-nitrophenyl)-phenylmethanone
methanimine;(2-nitrophenyl)-phenylmethanone (PubChem CID 174799548) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is methanimine;(2-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | methanimine;(2-nitrophenyl)-phenylmethanone |
| PubChem CID | 174799548 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | methanimine;(2-nitrophenyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].[H]N=C |
| InChI | InChI=1S/C13H9NO3.CH3N/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2/h1-9H;2H,1H2 |
| InChIKey | DNFZCIWVUWXQGB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanimine;(2-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;(2-nitrophenyl)-phenylmethanone?
The IUPAC name of methanimine;(2-nitrophenyl)-phenylmethanone (CID 174799548) is methanimine;(2-nitrophenyl)-phenylmethanone.
What is the SMILES notation for methanimine;(2-nitrophenyl)-phenylmethanone?
The canonical SMILES for methanimine;(2-nitrophenyl)-phenylmethanone is O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].[H]N=C.
What is the InChIKey of methanimine;(2-nitrophenyl)-phenylmethanone?
The InChIKey is DNFZCIWVUWXQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.CH3N/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2/h1-9H;2H,1H2.
What are the key properties of methanimine;(2-nitrophenyl)-phenylmethanone?
methanimine;(2-nitrophenyl)-phenylmethanone has a molecular weight of 256.26 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;(2-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 174799548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).