About (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne
(2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne (PubChem CID 174938163) has the molecular formula C19H15NO4
and a molecular weight of 321.33 g/mol. Its IUPAC name is (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne.
Molecular Properties
| Compound Name | (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne |
| PubChem CID | 174938163 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne |
| SMILES | C#CCOCC#C.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9NO3.C6H6O/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-3-5-7-6-4-2/h1-9H;1-2H,5-6H2 |
| InChIKey | STDXNXRQMPSKGS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne?
The IUPAC name of (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne (CID 174938163) is (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne.
What is the SMILES notation for (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne?
The canonical SMILES for (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne is C#CCOCC#C.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne?
The InChIKey is STDXNXRQMPSKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C6H6O/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-3-5-7-6-4-2/h1-9H;1-2H,5-6H2.
What are the key properties of (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne?
(2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne has a molecular weight of 321.33 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)-phenylmethanone;3-prop-2-ynoxyprop-1-yne is sourced from PubChem (CID 174938163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).